C17H15NO4S — CID 17497756
2-[2-(3-acetylanilino)-2-oxoethyl]sulfanylbenzoic acid (PubChem CID 17497756) has the molecular formula C17H15NO4S and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-[2-(3-acetylanilino)-2-oxoethyl]sulfanylbenzoic acid.
| Compound Name | 2-[2-(3-acetylanilino)-2-oxoethyl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 17497756 |
| Molecular Formula | C17H15NO4S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 2-[2-(3-acetylanilino)-2-oxoethyl]sulfanylbenzoic acid |
| SMILES | CC(=O)c1cccc(NC(=O)CSc2ccccc2C(=O)O)c1 |
| InChI | InChI=1S/C17H15NO4S/c1-11(19)12-5-4-6-13(9-12)18-16(20)10-23-15-8-3-2-7-14(15)17(21)22/h2-9H,10H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | HUVYEZAUCYNRDW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |