C16H12ClNO5S — CID 5303183
5-[[2-(2-carboxyphenyl)sulfanylacetyl]amino]-2-chlorobenzoic acid (PubChem CID 5303183) has the molecular formula C16H12ClNO5S and a molecular weight of 365.79 g/mol. Its IUPAC name is 5-[[2-(2-carboxyphenyl)sulfanylacetyl]amino]-2-chlorobenzoic acid.
| Compound Name | 5-[[2-(2-carboxyphenyl)sulfanylacetyl]amino]-2-chlorobenzoic acid |
|---|---|
| PubChem CID | 5303183 |
| Molecular Formula | C16H12ClNO5S |
| Molecular Weight | 365.79 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | 5-[[2-(2-carboxyphenyl)sulfanylacetyl]amino]-2-chlorobenzoic acid |
| SMILES | O=C(CSc1ccccc1C(=O)O)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H12ClNO5S/c17-12-6-5-9(7-11(12)16(22)23)18-14(19)8-24-13-4-2-1-3-10(13)15(20)21/h1-7H,8H2,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | FAXZAILHOFBGRE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.79 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |