C23H13Cl5N2O6S — CID 18895956
2-[[3-[2-(3-carboxy-4-chloroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid (PubChem CID 18895956) has the molecular formula C23H13Cl5N2O6S and a molecular weight of 622.70 g/mol. Its IUPAC name is 2-[[3-[2-(3-carboxy-4-chloroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid.
| Compound Name | 2-[[3-[2-(3-carboxy-4-chloroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| PubChem CID | 18895956 |
| Molecular Formula | C23H13Cl5N2O6S |
| Molecular Weight | 622.70 g/mol |
| Exact Mass | 619.89 |
| IUPAC Name | 2-[[3-[2-(3-carboxy-4-chloroanilino)-2-oxoethyl]sulfanylphenyl]carbamoyl]-3,4,5,6-tetrachlorobenzoic acid |
| SMILES | O=C(CSc1cccc(NC(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)c1)Nc1ccc(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C23H13Cl5N2O6S/c24-13-5-4-10(7-12(13)22(33)34)29-14(31)8-37-11-3-1-2-9(6-11)30-21(32)15-16(23(35)36)18(26)20(28)19(27)17(15)25/h1-7H,8H2,(H,29,31)(H,30,32)(H,33,34)(H,35,36) |
| InChIKey | PGCNJSOAXBRYFE-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.70 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|