C23H15Cl4NO5S — CID 18894783
2,3,4,5-tetrachloro-6-[[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid (PubChem CID 18894783) has the molecular formula C23H15Cl4NO5S and a molecular weight of 559.25 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 18894783 |
| Molecular Formula | C23H15Cl4NO5S |
| Molecular Weight | 559.25 g/mol |
| Exact Mass | 556.94 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylphenyl]carbamoyl]benzoic acid |
| SMILES | COc1cccc(C(=O)CSc2cccc(NC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c3C(=O)O)c2)c1 |
| InChI | InChI=1S/C23H15Cl4NO5S/c1-33-13-6-2-4-11(8-13)15(29)10-34-14-7-3-5-12(9-14)28-22(30)16-17(23(31)32)19(25)21(27)20(26)18(16)24/h2-9H,10H2,1H3,(H,28,30)(H,31,32) |
| InChIKey | IHPDOGORDDYZOC-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.25 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|