C19H17NO5S — CID 18894837
(E)-4-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 18894837) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is (E)-4-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18894837 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | (E)-4-[3-[2-(3-methoxyphenyl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | COc1cccc(C(=O)CSc2cccc(NC(=O)/C=C/C(=O)O)c2)c1 |
| InChI | InChI=1S/C19H17NO5S/c1-25-15-6-2-4-13(10-15)17(21)12-26-16-7-3-5-14(11-16)20-18(22)8-9-19(23)24/h2-11H,12H2,1H3,(H,20,22)(H,23,24)/b9-8+ |
| InChIKey | JWQJROHDBQTYAN-CMDGGOBGSA-N |
| XLogP | 3.25 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|