C25H19NO4S — CID 18894841
(E)-4-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid (PubChem CID 18894841) has the molecular formula C25H19NO4S and a molecular weight of 429.50 g/mol. Its IUPAC name is (E)-4-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 18894841 |
| Molecular Formula | C25H19NO4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | (E)-4-[3-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylanilino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C=C/C(=O)Nc1cccc(SCC(=O)c2ccc3c(c2)Cc2ccccc2-3)c1 |
| InChI | InChI=1S/C25H19NO4S/c27-23(17-8-9-22-18(13-17)12-16-4-1-2-7-21(16)22)15-31-20-6-3-5-19(14-20)26-24(28)10-11-25(29)30/h1-11,13-14H,12,15H2,(H,26,28)(H,29,30)/b11-10+ |
| InChIKey | GVOVKQZAZSZNCT-ZHACJKMWSA-N |
| XLogP | 4.81 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|