C26H19NO3S — CID 22778319
N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]furan-2-carboxamide (PubChem CID 22778319) has the molecular formula C26H19NO3S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]furan-2-carboxamide.
| Compound Name | N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 22778319 |
| Molecular Formula | C26H19NO3S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | N-[4-[2-(9H-fluoren-2-yl)-2-oxoethyl]sulfanylphenyl]furan-2-carboxamide |
| SMILES | O=C(CSc1ccc(NC(=O)c2ccco2)cc1)c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C26H19NO3S/c28-24(18-7-12-23-19(15-18)14-17-4-1-2-5-22(17)23)16-31-21-10-8-20(9-11-21)27-26(29)25-6-3-13-30-25/h1-13,15H,14,16H2,(H,27,29) |
| InChIKey | OITHSFVCMDGUMG-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |