C21H16ClNOS — CID 1284497
2-(4-chlorophenyl)sulfanyl-N-(9H-fluoren-2-yl)acetamide (PubChem CID 1284497) has the molecular formula C21H16ClNOS and a molecular weight of 365.89 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(9H-fluoren-2-yl)acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(9H-fluoren-2-yl)acetamide |
|---|---|
| PubChem CID | 1284497 |
| Molecular Formula | C21H16ClNOS |
| Molecular Weight | 365.89 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(9H-fluoren-2-yl)acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C21H16ClNOS/c22-16-5-8-18(9-6-16)25-13-21(24)23-17-7-10-20-15(12-17)11-14-3-1-2-4-19(14)20/h1-10,12H,11,13H2,(H,23,24) |
| InChIKey | IFKNKHBYYPRUGN-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.89 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |