C14H11ClFNOS — CID 738704
2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)acetamide (PubChem CID 738704) has the molecular formula C14H11ClFNOS and a molecular weight of 295.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 738704 |
| Molecular Formula | C14H11ClFNOS |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(CSc1ccc(Cl)cc1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H11ClFNOS/c15-10-1-7-13(8-2-10)19-9-14(18)17-12-5-3-11(16)4-6-12/h1-8H,9H2,(H,17,18) |
| InChIKey | URICZDJRKRXLCK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |