C16H14FNO2S — CID 2194131
N-(4-acetylphenyl)-2-(4-fluorophenyl)sulfanylacetamide (PubChem CID 2194131) has the molecular formula C16H14FNO2S and a molecular weight of 303.36 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(4-fluorophenyl)sulfanylacetamide.
| Compound Name | N-(4-acetylphenyl)-2-(4-fluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 2194131 |
| Molecular Formula | C16H14FNO2S |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-(4-acetylphenyl)-2-(4-fluorophenyl)sulfanylacetamide |
| SMILES | CC(=O)c1ccc(NC(=O)CSc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H14FNO2S/c1-11(19)12-2-6-14(7-3-12)18-16(20)10-21-15-8-4-13(17)5-9-15/h2-9H,10H2,1H3,(H,18,20) |
| InChIKey | WRCFBYSERQXWOK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |