C21H18N2O3S2 — CID 22775651
N-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide (PubChem CID 22775651) has the molecular formula C21H18N2O3S2 and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 22775651 |
| Molecular Formula | C21H18N2O3S2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | N-[4-[2-(4-acetylanilino)-2-oxoethyl]sulfanylphenyl]thiophene-2-carboxamide |
| SMILES | CC(=O)c1ccc(NC(=O)CSc2ccc(NC(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C21H18N2O3S2/c1-14(24)15-4-6-16(7-5-15)22-20(25)13-28-18-10-8-17(9-11-18)23-21(26)19-3-2-12-27-19/h2-12H,13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | OMZYZOGWFWUGPE-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |