C20H19N3O4S3 — CID 23095595
N-(4-acetamidophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide (PubChem CID 23095595) has the molecular formula C20H19N3O4S3 and a molecular weight of 461.59 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 23095595 |
| Molecular Formula | C20H19N3O4S3 |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[4-(thiophen-2-ylsulfonylamino)phenyl]sulfanylacetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CSc2ccc(NS(=O)(=O)c3cccs3)cc2)cc1 |
| InChI | InChI=1S/C20H19N3O4S3/c1-14(24)21-15-4-6-16(7-5-15)22-19(25)13-29-18-10-8-17(9-11-18)23-30(26,27)20-3-2-12-28-20/h2-12,23H,13H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | JEMDHVQWNDDASG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |