C22H22N2O3S2 — CID 94841476
N-[4-[(4-methylphenyl)sulfamoyl]phenyl]-2-(4-methylphenyl)sulfanylacetamide (PubChem CID 94841476) has the molecular formula C22H22N2O3S2 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-[4-[(4-methylphenyl)sulfamoyl]phenyl]-2-(4-methylphenyl)sulfanylacetamide.
| Compound Name | N-[4-[(4-methylphenyl)sulfamoyl]phenyl]-2-(4-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 94841476 |
| Molecular Formula | C22H22N2O3S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | N-[4-[(4-methylphenyl)sulfamoyl]phenyl]-2-(4-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2ccc(NC(=O)CSc3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C22H22N2O3S2/c1-16-3-7-19(8-4-16)24-29(26,27)21-13-9-18(10-14-21)23-22(25)15-28-20-11-5-17(2)6-12-20/h3-14,24H,15H2,1-2H3,(H,23,25) |
| InChIKey | DSSAWQPFSNQRHZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |