C21H18N2O5S2 — CID 22781476
4-[[2-[4-(benzenesulfonamido)phenyl]sulfanylacetyl]amino]benzoic acid (PubChem CID 22781476) has the molecular formula C21H18N2O5S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 4-[[2-[4-(benzenesulfonamido)phenyl]sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-[4-(benzenesulfonamido)phenyl]sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 22781476 |
| Molecular Formula | C21H18N2O5S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 4-[[2-[4-(benzenesulfonamido)phenyl]sulfanylacetyl]amino]benzoic acid |
| SMILES | O=C(CSc1ccc(NS(=O)(=O)c2ccccc2)cc1)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C21H18N2O5S2/c24-20(22-16-8-6-15(7-9-16)21(25)26)14-29-18-12-10-17(11-13-18)23-30(27,28)19-4-2-1-3-5-19/h1-13,23H,14H2,(H,22,24)(H,25,26) |
| InChIKey | RPUPVOOPQYXREY-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |