C16H16N2O4S2 — CID 1321236
N-[4-(acetylsulfamoyl)phenyl]-2-phenylsulfanylacetamide (PubChem CID 1321236) has the molecular formula C16H16N2O4S2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 1321236 |
| Molecular Formula | C16H16N2O4S2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2-phenylsulfanylacetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)CSc2ccccc2)cc1 |
| InChI | InChI=1S/C16H16N2O4S2/c1-12(19)18-24(21,22)15-9-7-13(8-10-15)17-16(20)11-23-14-5-3-2-4-6-14/h2-10H,11H2,1H3,(H,17,20)(H,18,19) |
| InChIKey | GOHXDTYRPQVDGQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |