C14H14N4O6S2 — CID 25037986
N-[4-(acetylsulfamoyl)phenyl]-2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 25037986) has the molecular formula C14H14N4O6S2 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[4-(acetylsulfamoyl)phenyl]-2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-[4-(acetylsulfamoyl)phenyl]-2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 25037986 |
| Molecular Formula | C14H14N4O6S2 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | N-[4-(acetylsulfamoyl)phenyl]-2-[(4-hydroxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=O)CSc2nc(O)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C14H14N4O6S2/c1-8(19)18-26(23,24)10-4-2-9(3-5-10)15-13(22)7-25-14-16-11(20)6-12(21)17-14/h2-6H,7H2,1H3,(H,15,22)(H,18,19)(H2,16,17,20,21) |
| InChIKey | XTWOIKRLNPNORX-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 158.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |