C13H14N4O5S2 — CID 6324505
2-[(4-methoxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide (PubChem CID 6324505) has the molecular formula C13H14N4O5S2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[(4-methoxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(4-methoxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 6324505 |
| Molecular Formula | C13H14N4O5S2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 2-[(4-methoxy-6-oxo-1H-pyrimidin-2-yl)sulfanyl]-N-(4-sulfamoylphenyl)acetamide |
| SMILES | COc1cc(=O)[nH]c(SCC(=O)Nc2ccc(S(N)(=O)=O)cc2)n1 |
| InChI | InChI=1S/C13H14N4O5S2/c1-22-12-6-10(18)16-13(17-12)23-7-11(19)15-8-2-4-9(5-3-8)24(14,20)21/h2-6H,7H2,1H3,(H,15,19)(H2,14,20,21)(H,16,17,18) |
| InChIKey | SUWVFYTUFLSFLR-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |