C15H18N4O4S2 — CID 135460125
2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-(3-sulfamoylphenyl)acetamide (PubChem CID 135460125) has the molecular formula C15H18N4O4S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-(3-sulfamoylphenyl)acetamide.
| Compound Name | 2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-(3-sulfamoylphenyl)acetamide |
|---|---|
| PubChem CID | 135460125 |
| Molecular Formula | C15H18N4O4S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-[(6-oxo-4-propyl-1H-pyrimidin-2-yl)sulfanyl]-N-(3-sulfamoylphenyl)acetamide |
| SMILES | CCCc1cc(=O)[nH]c(SCC(=O)Nc2cccc(S(N)(=O)=O)c2)n1 |
| InChI | InChI=1S/C15H18N4O4S2/c1-2-4-10-8-13(20)19-15(18-10)24-9-14(21)17-11-5-3-6-12(7-11)25(16,22)23/h3,5-8H,2,4,9H2,1H3,(H,17,21)(H2,16,22,23)(H,18,19,20) |
| InChIKey | IREQTQLMZZBHQN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |