C14H14BrN3O3S — CID 135455797
N-(3-bromo-4-methoxyphenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 135455797) has the molecular formula C14H14BrN3O3S and a molecular weight of 384.26 g/mol. Its IUPAC name is N-(3-bromo-4-methoxyphenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(3-bromo-4-methoxyphenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 135455797 |
| Molecular Formula | C14H14BrN3O3S |
| Molecular Weight | 384.26 g/mol |
| Exact Mass | 382.99 |
| IUPAC Name | N-(3-bromo-4-methoxyphenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | COc1ccc(NC(=O)CSc2nc(C)cc(=O)[nH]2)cc1Br |
| InChI | InChI=1S/C14H14BrN3O3S/c1-8-5-12(19)18-14(16-8)22-7-13(20)17-9-3-4-11(21-2)10(15)6-9/h3-6H,7H2,1-2H3,(H,17,20)(H,16,18,19) |
| InChIKey | CJSFIWCUEHSVMF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.26 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |