C13H12IN3O2S — CID 137144407
N-(3-iodophenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide (PubChem CID 137144407) has the molecular formula C13H12IN3O2S and a molecular weight of 401.23 g/mol. Its IUPAC name is N-(3-iodophenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide.
| Compound Name | N-(3-iodophenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 137144407 |
| Molecular Formula | C13H12IN3O2S |
| Molecular Weight | 401.23 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | N-(3-iodophenyl)-2-[(4-methyl-6-oxo-1H-pyrimidin-2-yl)sulfanyl]acetamide |
| SMILES | Cc1cc(=O)[nH]c(SCC(=O)Nc2cccc(I)c2)n1 |
| InChI | InChI=1S/C13H12IN3O2S/c1-8-5-11(18)17-13(15-8)20-7-12(19)16-10-4-2-3-9(14)6-10/h2-6H,7H2,1H3,(H,16,19)(H,15,17,18) |
| InChIKey | RKHRCQLCWYHMNJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|