C19H22N4O5S — CID 136617047
2-[2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]-N-prop-2-enylacetamide (PubChem CID 136617047) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is 2-[2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 136617047 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 2-[2-[2-(3,4-dimethoxyanilino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cc1cc(=O)[nH]c(SCC(=O)Nc2ccc(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C19H22N4O5S/c1-4-7-20-16(24)9-13-10-17(25)23-19(22-13)29-11-18(26)21-12-5-6-14(27-2)15(8-12)28-3/h4-6,8,10H,1,7,9,11H2,2-3H3,(H,20,24)(H,21,26)(H,22,23,25) |
| InChIKey | IIQFBBULOMQGQX-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 122.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|