C16H16BrN3O2S — CID 136616805
2-[2-[(4-bromophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]-N-prop-2-enylacetamide (PubChem CID 136616805) has the molecular formula C16H16BrN3O2S and a molecular weight of 394.29 g/mol. Its IUPAC name is 2-[2-[(4-bromophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[2-[(4-bromophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 136616805 |
| Molecular Formula | C16H16BrN3O2S |
| Molecular Weight | 394.29 g/mol |
| Exact Mass | 393.01 |
| IUPAC Name | 2-[2-[(4-bromophenyl)methylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)Cc1cc(=O)[nH]c(SCc2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C16H16BrN3O2S/c1-2-7-18-14(21)8-13-9-15(22)20-16(19-13)23-10-11-3-5-12(17)6-4-11/h2-6,9H,1,7-8,10H2,(H,18,21)(H,19,20,22) |
| InChIKey | GTFYXEYPXWANKB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|