C15H14BrN3O4S — CID 135596753
methyl 2-[2-[2-(3-bromoanilino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate (PubChem CID 135596753) has the molecular formula C15H14BrN3O4S and a molecular weight of 412.27 g/mol. Its IUPAC name is methyl 2-[2-[2-(3-bromoanilino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate.
| Compound Name | methyl 2-[2-[2-(3-bromoanilino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate |
|---|---|
| PubChem CID | 135596753 |
| Molecular Formula | C15H14BrN3O4S |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | methyl 2-[2-[2-(3-bromoanilino)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate |
| SMILES | COC(=O)Cc1cc(=O)[nH]c(SCC(=O)Nc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C15H14BrN3O4S/c1-23-14(22)7-11-6-12(20)19-15(18-11)24-8-13(21)17-10-4-2-3-9(16)5-10/h2-6H,7-8H2,1H3,(H,17,21)(H,18,19,20) |
| InChIKey | JZIDTZKINNUSCG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |