C15H13ClN2O4S — CID 135596972
methyl 2-[2-[2-(2-chlorophenyl)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate (PubChem CID 135596972) has the molecular formula C15H13ClN2O4S and a molecular weight of 352.80 g/mol. Its IUPAC name is methyl 2-[2-[2-(2-chlorophenyl)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate.
| Compound Name | methyl 2-[2-[2-(2-chlorophenyl)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate |
|---|---|
| PubChem CID | 135596972 |
| Molecular Formula | C15H13ClN2O4S |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | methyl 2-[2-[2-(2-chlorophenyl)-2-oxoethyl]sulfanyl-6-oxo-1H-pyrimidin-4-yl]acetate |
| SMILES | COC(=O)Cc1cc(=O)[nH]c(SCC(=O)c2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H13ClN2O4S/c1-22-14(21)7-9-6-13(20)18-15(17-9)23-8-12(19)10-4-2-3-5-11(10)16/h2-6H,7-8H2,1H3,(H,17,18,20) |
| InChIKey | YVVWSLVJLGYKAQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 89.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |