C17H15N3O5S — CID 135596918
methyl 2-[2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetate (PubChem CID 135596918) has the molecular formula C17H15N3O5S and a molecular weight of 373.39 g/mol. Its IUPAC name is methyl 2-[2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetate.
| Compound Name | methyl 2-[2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetate |
|---|---|
| PubChem CID | 135596918 |
| Molecular Formula | C17H15N3O5S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | methyl 2-[2-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]-6-oxo-1H-pyrimidin-4-yl]acetate |
| SMILES | COC(=O)Cc1cc(=O)[nH]c(SCCN2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C17H15N3O5S/c1-25-14(22)9-10-8-13(21)19-17(18-10)26-7-6-20-15(23)11-4-2-3-5-12(11)16(20)24/h2-5,8H,6-7,9H2,1H3,(H,18,19,21) |
| InChIKey | AIHHFKAZLDDLAT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 109.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|