C21H19N3O5S — CID 136687376
methyl 3-[[2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 136687376) has the molecular formula C21H19N3O5S and a molecular weight of 425.47 g/mol. Its IUPAC name is methyl 3-[[2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 136687376 |
| Molecular Formula | C21H19N3O5S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | methyl 3-[[2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CSc2nc(COc3ccccc3)cc(=O)[nH]2)c1 |
| InChI | InChI=1S/C21H19N3O5S/c1-28-20(27)14-6-5-7-15(10-14)22-19(26)13-30-21-23-16(11-18(25)24-21)12-29-17-8-3-2-4-9-17/h2-11H,12-13H2,1H3,(H,22,26)(H,23,24,25) |
| InChIKey | MNSJOKXBCMUHAO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |