C23H23N3O4S — CID 136687468
N-(3-acetylphenyl)-2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]butanamide (PubChem CID 136687468) has the molecular formula C23H23N3O4S and a molecular weight of 437.52 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]butanamide.
| Compound Name | N-(3-acetylphenyl)-2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 136687468 |
| Molecular Formula | C23H23N3O4S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-(3-acetylphenyl)-2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]butanamide |
| SMILES | CCC(Sc1nc(COc2ccccc2)cc(=O)[nH]1)C(=O)Nc1cccc(C(C)=O)c1 |
| InChI | InChI=1S/C23H23N3O4S/c1-3-20(22(29)24-17-9-7-8-16(12-17)15(2)27)31-23-25-18(13-21(28)26-23)14-30-19-10-5-4-6-11-19/h4-13,20H,3,14H2,1-2H3,(H,24,29)(H,25,26,28) |
| InChIKey | IREYDNYNYUQRBP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |