C23H23N3O5S — CID 136687511
ethyl 4-[2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]propanoylamino]benzoate (PubChem CID 136687511) has the molecular formula C23H23N3O5S and a molecular weight of 453.52 g/mol. Its IUPAC name is ethyl 4-[2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]propanoylamino]benzoate.
| Compound Name | ethyl 4-[2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]propanoylamino]benzoate |
|---|---|
| PubChem CID | 136687511 |
| Molecular Formula | C23H23N3O5S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | ethyl 4-[2-[[6-oxo-4-(phenoxymethyl)-1H-pyrimidin-2-yl]sulfanyl]propanoylamino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(C)Sc2nc(COc3ccccc3)cc(=O)[nH]2)cc1 |
| InChI | InChI=1S/C23H23N3O5S/c1-3-30-22(29)16-9-11-17(12-10-16)24-21(28)15(2)32-23-25-18(13-20(27)26-23)14-31-19-7-5-4-6-8-19/h4-13,15H,3,14H2,1-2H3,(H,24,28)(H,25,26,27) |
| InChIKey | HMFFILGDWIWWNJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |