C12H12N4O3S — CID 2238286
methyl 3-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzoate (PubChem CID 2238286) has the molecular formula C12H12N4O3S and a molecular weight of 292.32 g/mol. Its IUPAC name is methyl 3-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 2238286 |
| Molecular Formula | C12H12N4O3S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | methyl 3-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CSc2ncn[nH]2)c1 |
| InChI | InChI=1S/C12H12N4O3S/c1-19-11(18)8-3-2-4-9(5-8)15-10(17)6-20-12-13-7-14-16-12/h2-5,7H,6H2,1H3,(H,15,17)(H,13,14,16) |
| InChIKey | GGLBDHZEAFGWRL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |