C14H16N4O3S — CID 7784954
propyl 4-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzoate (PubChem CID 7784954) has the molecular formula C14H16N4O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is propyl 4-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzoate.
| Compound Name | propyl 4-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7784954 |
| Molecular Formula | C14H16N4O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | propyl 4-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)CSc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C14H16N4O3S/c1-2-7-21-13(20)10-3-5-11(6-4-10)17-12(19)8-22-14-15-9-16-18-14/h3-6,9H,2,7-8H2,1H3,(H,17,19)(H,15,16,18) |
| InChIKey | SGNMLMXMKYKTDT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |