C21H22N4O3S — CID 55342261
butyl 4-[[4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzoyl]amino]benzoate (PubChem CID 55342261) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is butyl 4-[[4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzoyl]amino]benzoate.
| Compound Name | butyl 4-[[4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 55342261 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | butyl 4-[[4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzoyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)c2ccc(CSc3ncn[nH]3)cc2)cc1 |
| InChI | InChI=1S/C21H22N4O3S/c1-2-3-12-28-20(27)17-8-10-18(11-9-17)24-19(26)16-6-4-15(5-7-16)13-29-21-22-14-23-25-21/h4-11,14H,2-3,12-13H2,1H3,(H,24,26)(H,22,23,25) |
| InChIKey | JVBGBQUNOZEEIT-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|