C23H27N5O3S — CID 55370125
N'-(4-hexoxybenzoyl)-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzohydrazide (PubChem CID 55370125) has the molecular formula C23H27N5O3S and a molecular weight of 453.57 g/mol. Its IUPAC name is N'-(4-hexoxybenzoyl)-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzohydrazide.
| Compound Name | N'-(4-hexoxybenzoyl)-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzohydrazide |
|---|---|
| PubChem CID | 55370125 |
| Molecular Formula | C23H27N5O3S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N'-(4-hexoxybenzoyl)-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNC(=O)c2ccc(CSc3ncn[nH]3)cc2)cc1 |
| InChI | InChI=1S/C23H27N5O3S/c1-2-3-4-5-14-31-20-12-10-19(11-13-20)22(30)27-26-21(29)18-8-6-17(7-9-18)15-32-23-24-16-25-28-23/h6-13,16H,2-5,14-15H2,1H3,(H,26,29)(H,27,30)(H,24,25,28) |
| InChIKey | HHYQWQAGRKVZNM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|