C13H19Cl2N5OS — CID 119405139
N-(3-aminopropyl)-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide;dihydrochloride (PubChem CID 119405139) has the molecular formula C13H19Cl2N5OS and a molecular weight of 364.30 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide;dihydrochloride.
| Compound Name | N-(3-aminopropyl)-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119405139 |
| Molecular Formula | C13H19Cl2N5OS |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | N-(3-aminopropyl)-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCNC(=O)c1ccc(CSc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C13H17N5OS.2ClH/c14-6-1-7-15-12(19)11-4-2-10(3-5-11)8-20-13-16-9-17-18-13;;/h2-5,9H,1,6-8,14H2,(H,15,19)(H,16,17,18);2*1H |
| InChIKey | MCIVBQLPTQCWMO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|