C14H17N5OS — CID 119449836
N-pyrrolidin-3-yl-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide (PubChem CID 119449836) has the molecular formula C14H17N5OS and a molecular weight of 303.39 g/mol. Its IUPAC name is N-pyrrolidin-3-yl-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide.
| Compound Name | N-pyrrolidin-3-yl-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 119449836 |
| Molecular Formula | C14H17N5OS |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | N-pyrrolidin-3-yl-4-(1H-1,2,4-triazol-5-ylsulfanylmethyl)benzamide |
| SMILES | O=C(NC1CCNC1)c1ccc(CSc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C14H17N5OS/c20-13(18-12-5-6-15-7-12)11-3-1-10(2-4-11)8-21-14-16-9-17-19-14/h1-4,9,12,15H,5-8H2,(H,18,20)(H,16,17,19) |
| InChIKey | OCXIEWDZJBCXIQ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |