C13H16N4O2 — CID 7376074
4-butoxy-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 7376074) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-butoxy-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 4-butoxy-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 7376074 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-butoxy-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C13H16N4O2/c1-2-3-8-19-11-6-4-10(5-7-11)12(18)16-13-14-9-15-17-13/h4-7,9H,2-3,8H2,1H3,(H2,14,15,16,17,18) |
| InChIKey | LVOSGPQWQVEIRV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|