C14H16N2O3 — CID 25236391
4-butoxy-N-(1,2-oxazol-3-yl)benzamide (PubChem CID 25236391) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is 4-butoxy-N-(1,2-oxazol-3-yl)benzamide.
| Compound Name | 4-butoxy-N-(1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 25236391 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 4-butoxy-N-(1,2-oxazol-3-yl)benzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2ccon2)cc1 |
| InChI | InChI=1S/C14H16N2O3/c1-2-3-9-18-12-6-4-11(5-7-12)14(17)15-13-8-10-19-16-13/h4-8,10H,2-3,9H2,1H3,(H,15,16,17) |
| InChIKey | LGMNYRMYWJWCFJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|