C10H10N4O2 — CID 62903794
6-(methylamino)-N-(1,2-oxazol-3-yl)pyridine-3-carboxamide (PubChem CID 62903794) has the molecular formula C10H10N4O2 and a molecular weight of 218.22 g/mol. Its IUPAC name is 6-(methylamino)-N-(1,2-oxazol-3-yl)pyridine-3-carboxamide.
| Compound Name | 6-(methylamino)-N-(1,2-oxazol-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 62903794 |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | 6-(methylamino)-N-(1,2-oxazol-3-yl)pyridine-3-carboxamide |
| SMILES | CNc1ccc(C(=O)Nc2ccon2)cn1 |
| InChI | InChI=1S/C10H10N4O2/c1-11-8-3-2-7(6-12-8)10(15)13-9-4-5-16-14-9/h2-6H,1H3,(H,11,12)(H,13,14,15) |
| InChIKey | ALLMHSDPXVXFLU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |