C10H6Cl2N2O2 — CID 17249127
3,5-dichloro-N-(1,2-oxazol-3-yl)benzamide (PubChem CID 17249127) has the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.08 g/mol. Its IUPAC name is 3,5-dichloro-N-(1,2-oxazol-3-yl)benzamide.
| Compound Name | 3,5-dichloro-N-(1,2-oxazol-3-yl)benzamide |
|---|---|
| PubChem CID | 17249127 |
| Molecular Formula | C10H6Cl2N2O2 |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 3,5-dichloro-N-(1,2-oxazol-3-yl)benzamide |
| SMILES | O=C(Nc1ccon1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H6Cl2N2O2/c11-7-3-6(4-8(12)5-7)10(15)13-9-1-2-16-14-9/h1-5H,(H,13,14,15) |
| InChIKey | SPUWITCKQRGTNG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |