C11H6F4N2O2 — CID 55131451
4-fluoro-N-(1,2-oxazol-3-yl)-3-(trifluoromethyl)benzamide (PubChem CID 55131451) has the molecular formula C11H6F4N2O2 and a molecular weight of 274.17 g/mol. Its IUPAC name is 4-fluoro-N-(1,2-oxazol-3-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-fluoro-N-(1,2-oxazol-3-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 55131451 |
| Molecular Formula | C11H6F4N2O2 |
| Molecular Weight | 274.17 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 4-fluoro-N-(1,2-oxazol-3-yl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccon1)c1ccc(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H6F4N2O2/c12-8-2-1-6(5-7(8)11(13,14)15)10(18)16-9-3-4-19-17-9/h1-5H,(H,16,17,18) |
| InChIKey | WSZJXZFQODPJDC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.17 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |