C11H8F3N3O2 — CID 971367
1-(1,2-oxazol-3-yl)-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 971367) has the molecular formula C11H8F3N3O2 and a molecular weight of 271.20 g/mol. Its IUPAC name is 1-(1,2-oxazol-3-yl)-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(1,2-oxazol-3-yl)-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 971367 |
| Molecular Formula | C11H8F3N3O2 |
| Molecular Weight | 271.20 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 1-(1,2-oxazol-3-yl)-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccon1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H8F3N3O2/c12-11(13,14)7-3-1-2-4-8(7)15-10(18)16-9-5-6-19-17-9/h1-6H,(H2,15,16,17,18) |
| InChIKey | ULSOADZJCWAILF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.20 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |