C13H13F3N4O — CID 108813241
1-(1,5-dimethylpyrazol-3-yl)-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 108813241) has the molecular formula C13H13F3N4O and a molecular weight of 298.27 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-3-yl)-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(1,5-dimethylpyrazol-3-yl)-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 108813241 |
| Molecular Formula | C13H13F3N4O |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-3-yl)-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | Cc1cc(NC(=O)Nc2ccccc2C(F)(F)F)nn1C |
| InChI | InChI=1S/C13H13F3N4O/c1-8-7-11(19-20(8)2)18-12(21)17-10-6-4-3-5-9(10)13(14,15)16/h3-7H,1-2H3,(H2,17,18,19,21) |
| InChIKey | XBICQQOYSQHDAO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |