C14H15F3N4O — CID 35283624
1-[2-(trifluoromethyl)phenyl]-3-(1,3,5-trimethylpyrazol-4-yl)urea (PubChem CID 35283624) has the molecular formula C14H15F3N4O and a molecular weight of 312.30 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)phenyl]-3-(1,3,5-trimethylpyrazol-4-yl)urea.
| Compound Name | 1-[2-(trifluoromethyl)phenyl]-3-(1,3,5-trimethylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 35283624 |
| Molecular Formula | C14H15F3N4O |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-[2-(trifluoromethyl)phenyl]-3-(1,3,5-trimethylpyrazol-4-yl)urea |
| SMILES | Cc1nn(C)c(C)c1NC(=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N4O/c1-8-12(9(2)21(3)20-8)19-13(22)18-11-7-5-4-6-10(11)14(15,16)17/h4-7H,1-3H3,(H2,18,19,22) |
| InChIKey | GOKGHNPZIZSZNV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |