C20H21F3N4O — CID 59808189
2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]-N-(1,3,5-trimethylpyrazol-4-yl)pyrrole-3-carboxamide (PubChem CID 59808189) has the molecular formula C20H21F3N4O and a molecular weight of 390.41 g/mol. Its IUPAC name is 2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]-N-(1,3,5-trimethylpyrazol-4-yl)pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]-N-(1,3,5-trimethylpyrazol-4-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59808189 |
| Molecular Formula | C20H21F3N4O |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]-N-(1,3,5-trimethylpyrazol-4-yl)pyrrole-3-carboxamide |
| SMILES | Cc1nn(C)c(C)c1NC(=O)c1cc(C)n(-c2ccccc2C(F)(F)F)c1C |
| InChI | InChI=1S/C20H21F3N4O/c1-11-10-15(19(28)24-18-12(2)25-26(5)14(18)4)13(3)27(11)17-9-7-6-8-16(17)20(21,22)23/h6-10H,1-5H3,(H,24,28) |
| InChIKey | QTVMIXUZQXPXOD-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|