C21H17F6N3O3S — CID 59807899
2,5-dimethyl-N-[4-sulfamoyl-3-(trifluoromethyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 59807899) has the molecular formula C21H17F6N3O3S and a molecular weight of 505.44 g/mol. Its IUPAC name is 2,5-dimethyl-N-[4-sulfamoyl-3-(trifluoromethyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[4-sulfamoyl-3-(trifluoromethyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59807899 |
| Molecular Formula | C21H17F6N3O3S |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | 2,5-dimethyl-N-[4-sulfamoyl-3-(trifluoromethyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(S(N)(=O)=O)c(C(F)(F)F)c2)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H17F6N3O3S/c1-11-9-14(12(2)30(11)17-6-4-3-5-15(17)20(22,23)24)19(31)29-13-7-8-18(34(28,32)33)16(10-13)21(25,26)27/h3-10H,1-2H3,(H,29,31)(H2,28,32,33) |
| InChIKey | XHJYOMMTAYXXCD-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 94.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|