C27H22F3N3O — CID 59807690
2,5-dimethyl-N-[4-[(E)-2-pyridin-2-ylethenyl]phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 59807690) has the molecular formula C27H22F3N3O and a molecular weight of 461.49 g/mol. Its IUPAC name is 2,5-dimethyl-N-[4-[(E)-2-pyridin-2-ylethenyl]phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[4-[(E)-2-pyridin-2-ylethenyl]phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59807690 |
| Molecular Formula | C27H22F3N3O |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2,5-dimethyl-N-[4-[(E)-2-pyridin-2-ylethenyl]phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(/C=C/c3ccccn3)cc2)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C27H22F3N3O/c1-18-17-23(19(2)33(18)25-9-4-3-8-24(25)27(28,29)30)26(34)32-22-14-11-20(12-15-22)10-13-21-7-5-6-16-31-21/h3-17H,1-2H3,(H,32,34)/b13-10+ |
| InChIKey | VTKBPKMLQBDNOR-JLHYYAGUSA-N |
| XLogP | 6.93 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|