C27H21F3N2O2 — CID 59807841
N-(3-benzoylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 59807841) has the molecular formula C27H21F3N2O2 and a molecular weight of 462.47 g/mol. Its IUPAC name is N-(3-benzoylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | N-(3-benzoylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59807841 |
| Molecular Formula | C27H21F3N2O2 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | N-(3-benzoylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2cccc(C(=O)c3ccccc3)c2)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C27H21F3N2O2/c1-17-15-22(18(2)32(17)24-14-7-6-13-23(24)27(28,29)30)26(34)31-21-12-8-11-20(16-21)25(33)19-9-4-3-5-10-19/h3-16H,1-2H3,(H,31,34) |
| InChIKey | MZYDPLKHGMKXQU-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|