C28H23F3N2O2 — CID 59807758
N-(2-benzoyl-5-methylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 59807758) has the molecular formula C28H23F3N2O2 and a molecular weight of 476.50 g/mol. Its IUPAC name is N-(2-benzoyl-5-methylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | N-(2-benzoyl-5-methylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59807758 |
| Molecular Formula | C28H23F3N2O2 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | N-(2-benzoyl-5-methylphenyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1ccc(C(=O)c2ccccc2)c(NC(=O)c2cc(C)n(-c3ccccc3C(F)(F)F)c2C)c1 |
| InChI | InChI=1S/C28H23F3N2O2/c1-17-13-14-21(26(34)20-9-5-4-6-10-20)24(15-17)32-27(35)22-16-18(2)33(19(22)3)25-12-8-7-11-23(25)28(29,30)31/h4-16H,1-3H3,(H,32,35) |
| InChIKey | QQDXPNXFBNYGKK-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|