C23H21F3N2O3 — CID 174531925
4-[2-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]ethyl]benzoic acid (PubChem CID 174531925) has the molecular formula C23H21F3N2O3 and a molecular weight of 430.43 g/mol. Its IUPAC name is 4-[2-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]ethyl]benzoic acid.
| Compound Name | 4-[2-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]ethyl]benzoic acid |
|---|---|
| PubChem CID | 174531925 |
| Molecular Formula | C23H21F3N2O3 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | 4-[2-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carbonyl]amino]ethyl]benzoic acid |
| SMILES | Cc1cc(C(=O)NCCc2ccc(C(=O)O)cc2)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H21F3N2O3/c1-14-13-18(15(2)28(14)20-6-4-3-5-19(20)23(24,25)26)21(29)27-12-11-16-7-9-17(10-8-16)22(30)31/h3-10,13H,11-12H2,1-2H3,(H,27,29)(H,30,31) |
| InChIKey | NQURSLKZEGMPBW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|