C22H21F3N2O5S — CID 135305277
2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid;4-methylsulfonylbenzamide (PubChem CID 135305277) has the molecular formula C22H21F3N2O5S and a molecular weight of 482.48 g/mol. Its IUPAC name is 2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid;4-methylsulfonylbenzamide.
| Compound Name | 2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid;4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 135305277 |
| Molecular Formula | C22H21F3N2O5S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxylic acid;4-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)c1ccc(C(N)=O)cc1.Cc1cc(C(=O)O)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H12F3NO2.C8H9NO3S/c1-8-7-10(13(19)20)9(2)18(8)12-6-4-3-5-11(12)14(15,16)17;1-13(11,12)7-4-2-6(3-5-7)8(9)10/h3-7H,1-2H3,(H,19,20);2-5H,1H3,(H2,9,10) |
| InChIKey | PPQGBVAJSWCFSO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 119.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|