C29H27F3N2O — CID 59808024
N-(2,2-diphenylpropyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide (PubChem CID 59808024) has the molecular formula C29H27F3N2O and a molecular weight of 476.54 g/mol. Its IUPAC name is N-(2,2-diphenylpropyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide.
| Compound Name | N-(2,2-diphenylpropyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59808024 |
| Molecular Formula | C29H27F3N2O |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | N-(2,2-diphenylpropyl)-2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)NCC(C)(c2ccccc2)c2ccccc2)c(C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C29H27F3N2O/c1-20-18-24(21(2)34(20)26-17-11-10-16-25(26)29(30,31)32)27(35)33-19-28(3,22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-18H,19H2,1-3H3,(H,33,35) |
| InChIKey | VKYBVARDKARZED-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|